1. Using standard free energy formation data, calculate the value of the equilibrium constants for the following reactions (all species are dissolved in water unless otherwise noted): a. H2O(l)=H++OH b. Fe(OH)2++2OH=Fe(OH)3(s) c. CO2(g)+H2O(I)=H2CO3 d. H2CO3=HCO3+H+ e. HCO3=H++CO32 f. CaCO3(S)=Ca2++CO32 2. Using equilibrium constants from problem 1, calculate the value of the equilibrium constant for the following reaction: CaCO3(S)+H2O=Ca2++HCO3+OH 3. Determine the molarity of the following solutions: a. 50g of NaHCO3 in 5L of solution b. 1g of NaCl in 2L of solution 4. Determine the molality and mole fraction of the salts in the following solutions: a. 1g of KCl and 1000g of pure water b. 2g of Na2CO3 and 950g of pure water 5. Calculate the mole fraction of water in the solutions of question 4. 6. Calculate the molarity of the following solutions: a. 50g/L of Se (selenium) b. 10g/L of Ar (arsenic)