Question: 3. Which is the cor rect IUPAC name for the given compound? a) 3-bromo-2-methyl-5-phenylpentane b) 3-bromo-4-methyl-1-phenylpentane c) 2-bromo-1,1-dimethyl-5-phenylpentane d) 3-bromo-2-methyl-6-phenylhexane e) 4-bromo-5-methyl-1-phenylhexane 4. Provide IUPAC
3. Which is the cor rect IUPAC name for the given compound? a) 3-bromo-2-methyl-5-phenylpentane b) 3-bromo-4-methyl-1-phenylpentane c) 2-bromo-1,1-dimethyl-5-phenylpentane d) 3-bromo-2-methyl-6-phenylhexane e) 4-bromo-5-methyl-1-phenylhexane 4. Provide IUPAC name for the following compound: CH3CH(CH3)C(CH3)2CH(Br)CH2CH(CH3)2
Step by Step Solution
There are 3 Steps involved in it
1 Expert Approved Answer
Step: 1 Unlock
Question Has Been Solved by an Expert!
Get step-by-step solutions from verified subject matter experts
Step: 2 Unlock
Step: 3 Unlock
Study Help