Can someone help me to answer this correctly, please, and explain it. Please answer these 2 short questions, I don't have more money to buy more questions. These 2 questions are different.

1. a.

1. b.

When the following molecular equation is balanced using the smallest possible integer coefficients, the values of these coefficients are: ammoniumnitrate(aq)dinitrogenmonoxide(g)+water(I) When the following molecular equation is balanced using the smallest possible integer coefficients, the values of these coefficients are: CS2(s)+Cl2(g)CCl4(I)+SCl2(s)