Can someone help me to answer this correctly, please, and explain it. Please answer these 2 short questions, I don't have more money to buy more questions. These 2 questions are different.

1. a.

1. b.

Enter the coefficients directly from the balanced chemical equation. Do not reduce to lowest terms. For example: If 3 moles H2 react with 3 moles O2, enter "3" for each, not "1". According to the following reaction: Cl2(g)+2NaI(s)2NaCl(s)+I2(s) What would you multiply "moles of chlorine" by to convert to the units "moles of iodine" ? When potassium hydrogen sulfate reacts with potassium hydroxide, potassium sulfate and water are produced. The balanced equation for this reaction is: KHSO4(aq)+KOH(aq)K2SO4(aq)+H2O(l) If 4 moles of potassium hydrogen sulfate react, The reaction consumes moles of potassium hydroxide. The reaction produces moles of potassium sulfate and moles of water