Chapter $3$ Homework Questions CHEM $65$:

NameWrite question numbers then your complete answers on separate paper and submit, along with this question page as a cover sheet. If workings required then you must show them for credit$\mathrm{.}1.$ What is the name and chemical symbol of the most abundant element in the Earth's crust $($be willing to Google this?$2.$

If the most abundant element in the Universe is hydrogen, suggest why hydrogen is in such low abundance on Earth.

$3."$ Give $3$ chemicals containing the elements P and O which exemplify the Law of Multiple Proportions.

$4.$ What is the name of the following compounds:$($a$)$ N$205($b$)$ KF$($c$)$ CoBI$($d$)($NH$.)3$PO$($e$)$ Na$,$SO$,($t$)$ V$3($PO$4)2($g$)$ HI$($h$)$ H$,$S$03($i$)$ H$,$S$04$

$5.$ What molecules are formed from the following species? Give formula and name for each:$($a$)$ strontium and hydrogen sulfate$($b$)$ rubidium and acetate$($c$)$ lithium and oxygen$($d$)$ potassium and cyanide$($e$)$ zinc and oxalate$($f$)$ magnesium and nitrogen$($g$)$ aluminum and oxygen$($h$)$ titanium $($IV$)$ and oxygen$($i$)$ tin$($Il$)$ and fluorine$($i$)$ iron$($III$)$ and hydroxide

$6.$ Which part of Dalton's atomic theory is no longer considered true today? State and explain.