Need help, with an explanation too if possible

While investigating mole ratios, a group of students collected data for the following chemical reaction: 2NaOH(aq)+CaCl2(aq)2NaCl(aq)+Ca(OH)2(s). The students wondered what would happen if an excess of NaOH was used. Their teacher approved a procedure in which solutions containing 3.00g of NaOH and 2.10g of CaCl2 were combined. Based on the quantities of these reactants, what amount of Ca(OH)2(s) is produced? A. 0.0189mol B. 0.0375mol C. 0.0500mol D. 0.1000mol In producing pure iron metal from its ore, iron(III) oxide and carbon (coke) must react according to the following balanced chemical equation: Fe2O3(s)+3C(s)2Fe(s)+3CO(g) Suppose 5.89103mol of iron ore are consumed. How many moles of pure iron metal are produced? A. 1.47103mol B. 2.95103mol C. 5.89103mol D. 1.18104mol