openng the bottle? Explan this by using Le Chateler's prncple. 4 marks) d) If you open the bottle and let all the gas escape, will adding more H2CO3 to the fizzy drink produce more carbon dioxide? Explain this by using Le Chtelier's principle. (2 marks) 3 CHE1503/102/1/2023 Question 5: a) The results of a titration experiment were as follows: Volume of aqueous NaOH pipetted into the conical flask =10.00mL Average volume of dilute HCl added from the burette to reach the endpoint =12.54mL Molarity of the dilute HCl=1.196M i) Write the chemical reaction equation for the titration reaction (2 marks) ii) Calculate the number of moles of HCl added during the titration (3 marks) iii) What is the number of moles of NaOH that has reacted during the titration iv) What is the molarity of the aqueous NaOH (3 marks) b) Suppose we titrate 20mL of 0.100MHCHO with 0.100MNaOH. Calculate the pH : i) Before any base is added. (3 marks) iii) After a total of 15.0ml of been neutralized. (3 marks) Question 6: a) Draw the following curves: i) A general titration curve for titrating a weak acid with a strong base (Let pH at the equivalence point be 10.00 ). (4 marks) ii) A general titration curve for titrating a weak base with a strong acid (Let the pH at the equivalence point be 4.00 ). (4 marks) b) Define the following: i) Standard solution ii) Primary standard iii) Equivalence point iv) End point v) Titration vi) Titration indicators (2 marks) (2 marks) (2 marks) (2 marks) (2 marks) Question 7: a) Balance the following reactions: i) PCl(s)+H2O(I)H3PO4(aq)+HCl(aq) ii) Mg3(PO4)2(aq)+NaOH(aq)Mg(OH)2(aq)+Na3PO4(aq) iii) C8H18(l)+O2(g)CO2(g)+H2O(l) iv) Na2S2O3(aq)+l2(s)Nal(aq)+NaS4O6(aq) v) PbS(s)+O2(g)PbO(s)+SO2(g) vi) Al(s)+S8(s)Al2S3(s) (2 marks) (12 marks) 4 CHE1503/102/1/2023 b) Use the solubility table to predict how you would test for the following ions in solution. Write a reaction and explain your choice: i) Ba2+ ii) Ag+ iii) 1 iv) g (8 marks)