Answer all questions correctly. Will receive upvote!

14. It is desirable that pesticides eventually decompose in the environment to give harmless products. If the half-life for the decomposition of a certain pesticide is 10.2 years, and the present concentration of this pesticide in a lake is 3.1105/mL, what was its concentration 4 years ago? 15. Common sugar, sucrose, reacts in dilute acid solution to give the simple sugars glucose and fructose. Both of the simple sugars have the same formula, C6H12O6. C12H22O11(eq)+H2O(1)2C6H12O6(29) The rate of this reaction has been studied in acid solution and the following data were obtained (a) Plot the data above as ln[C12H22O11] versus time and 1/[C12H22O11] versus time. What is the order of the reaction? (b) Write the rate law for the reaction and calculate the rate constant, k. (c) Estimate the concentration of sucrose after 175min. 16. In the transformation of cyclopropane to propene the reaction rate constant is 5.4102hr 1. If the initial concentration of cyclopropane is 0.050M, how many hours must elapse for the concentration to drop to 0.025M ? 17. For a reaction with the rate law "initial rate =k[A]0" and k=3.33106/hr, what is the half-life of the reaction? 18. The decomposition of N2O5 (to give NO2 and O2 ) follows the rate law (a) What is the half-life of the reaction? (b) How long does it take for [N2O5] to drop to one tenth of its original value? 19. Nitrogen dioxide reacts with ozone to form dinitrogen pentoxide and oxygen. The equation for the reaction is: 2NO2(s)+O3(g)N2O5(g)+O2 (c) The rate law for the reaction is given by: initial rate =k[NO2][O3] Propose a two-step mechanism for the reaction that conforms to the rate law