Question: At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.0206s1 : ClCH2CH2Cl(g)CH2CHCl(g)+HCl(g) Suppose a vessel contains ClCH2CH2Cl at a concentration

At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.0206s1 : ClCH2CH2Cl(g)CH2CHCl(g)+HCl(g) Suppose a vessel contains ClCH2CH2Cl at a concentration of 0.260M. Calculate how long it takes for the concentration of ClCH2CHCl2Cl to decrease to 20.0% of its initial value. You may assume no other reaction is important. Round your answer to 2 significant digits

Step by Step Solution

There are 3 Steps involved in it

1 Expert Approved Answer

Step: 1 Unlock blur-text-image

Question Has Been Solved by an Expert!

Get step-by-step solutions from verified subject matter experts

Step: 2 Unlock

Step: 3 Unlock

Students Have Also Explored These Related Chemistry Questions!

At a certain temperature this reaction follows second-order kinetics with a rate constant of 0.123Ms: 2SO3 (g) 2SO (g) + O(g) Suppose a vessel contains SO3 at a concentration of 0.300M. Calculate the...

At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.0134 is 1 : ClCH2CH2Cl(g)CH2CHCl(g)+HCl(g) Suppose a vessel contains ClCH2CH2Cl at a concentration of...

At a certain temperature this reaction follows first-order kinetics with a rate constant of 1.90s1 : 2NH3(g)N2(g)+3H2(g) Suppose a vessel contains NH3 at a concentration of 1.08M. Calculate how long...

At a certain temperature this reaction follows first-order kinetics with a rate constant of :2.94s1 2SO3g+2SO2gO2g Suppose a vessel contains SO3 at a concentration of 0.150M. Calculate how long it...

At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.0032s1, 2SO3(g)2SO2(g)+O2(g) Suppose a vessel contains SO3 at a concentration of 0.940M. Calculate how...

At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.883s1 : 2H3PO4(aq)P2O5(aq)+3H2O(aq) Suppose a vessel contains H3PO4 at a concentration of 0.790M....

At a certain temperature this reaction follows first-order kinetics with a rate constant of 1.59s1 : 2NH3(g)N2(g)+3H2(g) Suppose a vessel contains NH3 at a concentration of 0.530M. Calculate how long...

At a certain temperature this reaction follows first-order kinetics with a rate constant of :0.0557s1 H2CO3aq+H2OaqCO2aq Suppose a vessel contains H2CO3 at a concentration of 1.20M. Calculate how...

At a certain temperature this reaction follows first-order kinetics with a rate constant of 9.03s1 : 2H3PO4(aq)P2O5(aq)+3H2O(aq) Suppose a vessel contains H3PO4 at a concentration of 0.500M....

At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.0066 s 2HI (g) H, (g) + 1 (g) : Suppose a vessel contains HI at a concentration of 0.220M. Calculate how...

Match the information below 1. Function to calculate value of the end of a financial transaction 2. Function to calculate the interest percentage per period of a financial transaction 3. Function to...

A recommendation memo is a routinely used document in leading firms and you may be writing such memos as part of an internship. Therefore it is essential that you gain some practice at writing them....

asan Songbird sold a computer used in her usiness for $ 1 0 5 0 . She had purchased the mputer three years ago for $ 9 5 0 and has taken 3 0 0 in depreciation. How much and what type of ain or loss...

Briefly describe the seven coding methods used by companies with examples.?

4-66. WRITING: USING PLAIN LANGUAGE, CREATING PROFESSIONAL EMAIL [LO-3] In a group of three, analyze the style and tone of the following memo. How does the writer come across? What action does the...

4-65. WRITING: CREATING PROFESSIONAL TONE [LO-3] Write the following message in three ways to create (1) a friendly, informal tone; (2) a neutral tone; and (3) a firm, formal tone. You are an...

4-63. WRITING: USING PLAIN LANGUAGE; MEDIA SKILLS: BLOGGING [LO-3] Search for the BC governments Plain Language Guide at www2.gov.bc.ca. In one or two sentences, summarize what they mean by the...