Question: At a certain temperature this reaction follows first-order kinetics with a rate constant of 9.03s1 : 2H3PO4(aq)P2O5(aq)+3H2O(aq) Suppose a vessel contains H3PO4 at a concentration

At a certain temperature this reaction follows first-order kinetics with a

At a certain temperature this reaction follows first-order kinetics with a rate constant of 9.03s1 : 2H3PO4(aq)P2O5(aq)+3H2O(aq) Suppose a vessel contains H3PO4 at a concentration of 0.500M. Calculate how long it takes for the concentration of H3PO4 to decrease to 0.0750M. You may assume no other reaction is important. Round your answer to 2 significant digits

Step by Step Solution

There are 3 Steps involved in it

1 Expert Approved Answer

Step: 1 Unlock blur-text-image

Question Has Been Solved by an Expert!

Get step-by-step solutions from verified subject matter experts

Step: 2 Unlock

Step: 3 Unlock

Students Have Also Explored These Related Chemistry Questions!

In theory of constraints (TOC), original orders may be divided into smaller quantities called a. Transfer batches b. Sub-projects c. Bottleneck quantities d. Buffers

At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.883s1 : 2H3PO4(aq)P2O5(aq)+3H2O(aq) Suppose a vessel contains H3PO4 at a concentration of 0.790M....

At a certain temperature this reaction follows first-order kinetics with a rate constant of 1.90s1 : 2NH3(g)N2(g)+3H2(g) Suppose a vessel contains NH3 at a concentration of 1.08M. Calculate how long...

At a certain temperature this reaction follows first-order kinetics with a rate constant of :2.94s1 2SO3g+2SO2gO2g Suppose a vessel contains SO3 at a concentration of 0.150M. Calculate how long it...

At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.0032s1, 2SO3(g)2SO2(g)+O2(g) Suppose a vessel contains SO3 at a concentration of 0.940M. Calculate how...

At a certain temperature this reaction follows first-order kinetics with a rate constant of 1.59s1 : 2NH3(g)N2(g)+3H2(g) Suppose a vessel contains NH3 at a concentration of 0.530M. Calculate how long...

At a certain temperature this reaction follows first-order kinetics with a rate constant of :0.0557s1 H2CO3aq+H2OaqCO2aq Suppose a vessel contains H2CO3 at a concentration of 1.20M. Calculate how...

At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.0206s1 : ClCH2CH2Cl(g)CH2CHCl(g)+HCl(g) Suppose a vessel contains ClCH2CH2Cl at a concentration of...

At a certain temperature this reaction follows second-order kinetics with a rate constant of 23.M1 ' s1 : 2H3PO4(aq)P2O5(aq)+3H2O(aq) Suppose a vessel contains H3PO4 at a concentration of 1.00M....

help At a certain temperature this reaction follows second-order kinetics with a rate constant of 1.67M1s1; 2HI(g)H2(g)+I2(g) Suppose a vessel contains HI at a concentration of 0.500M. Calculate how...

At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.0066 s 2HI (g) H, (g) + 1 (g) : Suppose a vessel contains HI at a concentration of 0.220M. Calculate how...

Why is the exercise of power necessary for organizations to operate effectively? What are some of the ways in which people gain power in organizations?

The units of magnetic induction B, in the International System of Units SI, is: a) the watt or watt b) the coulomb or coulomb c) the ampere or ampere d) the tesla

You are going to purchase a 5 - year annuity that pays you $ 1 0 0 a year, starting next year. The appropriate discount rate is 1 0 % . What is the fair price of the annuity? Round to the nearest...

C++ In this project, you will write a program to calculate the area of a triangle. Your program should "keeps reading" three sides a, b, and c until they are valid and then calculate the area. You...

What is the fundamental difference in the creative tactics needed for recognition versus recall brand awareness?

Why is consistency in IMC executions so important?

Discuss the importance of eliciting the correct emotional sequence in marketing communication.