Question: At a certain temperature this reaction follows first-order kinetics with a rate constant of 9.78104s1 : 2HI(g)H2(g)+I2(g) Suppose a vessel contains HI at a concentration

At a certain temperature this reaction follows first-order kinetics with a rate constant of 9.78104s1 : 2HI(g)H2(g)+I2(g) Suppose a vessel contains HI at a concentration of 1.49M. Calculate the concentration of HI in the vessel 980 . seconds later. You may assume no other reaction is important. Round your answer to 2 significant digits

Step by Step Solution

There are 3 Steps involved in it

1 Expert Approved Answer

Step: 1 Unlock blur-text-image

Question Has Been Solved by an Expert!

Get step-by-step solutions from verified subject matter experts

Step: 2 Unlock

Step: 3 Unlock

Students Have Also Explored These Related Chemistry Questions!

Dr. Mfum Smiles, a physically challenged man, is a lecturer at a public university in Ghana, School of Veterinary Medicine. He dedicates most of his free time providing consultancy services in animal...

At a certain temperature this reaction follows second-order kinetics with a rate constant of 0.123Ms: 2SO3 (g) 2SO (g) + O(g) Suppose a vessel contains SO3 at a concentration of 0.300M. Calculate the...

using integrated rate law At a certain temperature this reaction follows first-order kinetics with a rate constant of 2.51 s 1 : 2HI(g)H2(g)+H2(g) Suppose a vessel contains HI at a concentration of...

round to 2 sig fig At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.006321 : 2HI(g)H2(g)+I2(g) Suppose a vessel contains HI at a concentration of 1.49 M....

Using an integrated rate law At a certain temperature this reaction follows first-order kinetics with a rate constant of 1.15 s 1 : 2SO3(g)2SO2(g)+O2(g) Suppose a vessel contains SO3 at a...

At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.00262 5-?: 2N,05 (9) 2N204(9) +02 (8) + Suppose a vessel contains N2O5 at a concentration of 0.920 M....

At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.0134 is 1 : ClCH2CH2Cl(g)CH2CHCl(g)+HCl(g) Suppose a vessel contains ClCH2CH2Cl at a concentration of...

At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.0066 s 2HI (g) H, (g) + 1 (g) : Suppose a vessel contains HI at a concentration of 0.220M. Calculate how...

At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.00717s1 : H2CO3(aq)H2O(aq)+CO2(aq) Suppose a vessel contains H2CO3 at a concentration of 1.49M, Calculate...

round to two sigfigs please!!! At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.00427s1; 2HI(g)H2(g)+I2(g) Suppose a vessel contains HI at a concentration...

Using rate law At a certain temperature this reaction follows first-order kinetics with a fate constant of 2.51 is 1 : 2HI(g)H2(g)+I2(g) Suppose a vessel contains HI at a concentration of 0.900M....

Staff members from the marketing department of your firm are doing a splendid job selling products to customers. Many of the customers are so pleased, in fact, they are also buying shares in the...

The 20 numbers in list A have an average of 9.5. The 10 numbers in list B have an average of 8.3. If the two lists are combined to make a new list, what is the average of the 30 numbers in the new...

The following information is relevant: ( i ) The fair value of Siva Bhd ' s assets were equal to their carrying amounts with the exception of land and plant. Siva Bhd ' s land had a fair value of RM...

Questions Q1. Write a Python program to retrieve the first and last colors from the following list: color_list = ["red", "green", "white", "blue", "black") Q2. Given the following dictionary,...

4. Which of the following is the correct name for the idea that certain firms prefer government regulation because regulation shields them from the pressures of competition and, in effect, guarantees...

2. How would you expect antitrust authorities to react to: LO21.2 a. A proposed merger of Ford and General Motors. b. Evidence of secret meetings by contractors to rig bids for highway construction...

12. Use economic analysis to explain why the optimal amount of product safety may be less than the amount that would totally eliminate the risk of accidents and deaths. Use automobiles as an example....