Question: round to 2 sig fig At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.006321 : 2HI(g)H2(g)+I2(g) Suppose a vessel

round to 2 sig fig At a certain temperature this reaction

round to 2 sig fig

At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.006321 : 2HI(g)H2(g)+I2(g) Suppose a vessel contains HI at a concentration of 1.49 M. Calculate the concentration of HI in the vessel 98.0 seconds later. You may assume no other reaction 16 important. Round your answer to 2 significant digits

Step by Step Solution

There are 3 Steps involved in it

1 Expert Approved Answer

Step: 1 Unlock blur-text-image

Question Has Been Solved by an Expert!

Get step-by-step solutions from verified subject matter experts

Step: 2 Unlock

Step: 3 Unlock

Students Have Also Explored These Related Chemistry Questions!

round to 2 sig figures At a certain temperature this reaction follows second-order kinetics with a rate constant of 15.5M1s1 : 2H3PO4(aq)P2O5(aq)+3H2O(aq) Suppose a vessel contains H3PO4 at a...

round to two sigfigs please!!! At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.00427s1; 2HI(g)H2(g)+I2(g) Suppose a vessel contains HI at a concentration...

using integrated rate law At a certain temperature this reaction follows first-order kinetics with a rate constant of 2.51 s 1 : 2HI(g)H2(g)+H2(g) Suppose a vessel contains HI at a concentration of...

Using rate law At a certain temperature this reaction follows first-order kinetics with a fate constant of 2.51 is 1 : 2HI(g)H2(g)+I2(g) Suppose a vessel contains HI at a concentration of 0.900M....

Using an integrated rate law At a certain temperature this reaction follows first-order kinetics with a rate constant of 1.15 s 1 : 2SO3(g)2SO2(g)+O2(g) Suppose a vessel contains SO3 at a...

At a certain temperature this reaction follows second-order kinetics with a rate constant of 0.00851M1 's 1; 2HI(g)H2(g)+H2(g) Suppose a vessel contains HI at a concentration of 1.09M. Calculate the...

At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.0134 is 1 : ClCH2CH2Cl(g)CH2CHCl(g)+HCl(g) Suppose a vessel contains ClCH2CH2Cl at a concentration of...

At a certain temperature this reaction follows first-order kinetics with a rate constant of 9.78104s1 : 2HI(g)H2(g)+I2(g) Suppose a vessel contains HI at a concentration of 1.49M. Calculate the...

integrated rate law At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.00213s. 2NH3(g)N2(g)+3H2(g) Suppose a vessel contains NH3 at a concentration of...

At a certain temperature this reaction follows first-order kinetics with a rate constant of 0.00717s1 : H2CO3(aq)H2O(aq)+CO2(aq) Suppose a vessel contains H2CO3 at a concentration of 1.49M, Calculate...

Define r and s as scalars r = 1.6 x 103 and s = 14.2, and, t, x, and y as vectors t = [1, 2, 3, 4, 5], x = [0, 2, 4, 6, 8], and y = [3, 6, 9, 12, 15]. Then use these variables to calculate the...

Following is information about consulting jobs for a company that is increasing in sales, but has not yet become profitable. The owner keeps financial records on yellow sticky notes stuck to the wall...

The total amount of cash and other assets that a corporation recelves from its stocitholders in exchange for its stock is: Mutiple Choice Alwiyn below its stated value. Alwity equal to is itabed...

can someone help ? were using Java attach file header block comments please Exercise Write a method intersect that accepts two sorted array lists of integers as parameters and returns a new list that...

5. The LM curve slopes upward because income increases money and, in turn, the interest rate. a. higher, supply b. higher, demand c. lower, supply d. lower, demand

6. At the intersection of the IS and LM curves, a. the economy is at full employment. b. the economy has the right balance of inflation and unemployment. c. the goods market and money market are both...

3. The IS curve slopes downward because a interest rate reduces and thus income. a. higher, planned investment b. higher, money demand c. lower, planned investment d. lower, money demand