mutant isoform (confirming your active site). They also reduce the growth of Neuroblastoma cell culture. Analyse the following table and let Holien-X know which compound you would choose to develop further and why? (up to 12 page and/or table/figures) SMILES String Activity (IC50) O=C(C1=CC=CC(CI)=C1F)N(CC2)CCN2CC3=CC=CC(CC4=NC=CS4)=N3 1nM CN(C)CC1=CC(C2=CC(C(C3=CN(CC)N=C3C4=CC=CC=C4)=NC=N5)=C5N2)=CC=C 0.5nM 1 CCN1N=C(C2=CC=C(F)C=C2)C([C@H]3CCCC(C(F)(F)F)C3)=C1 1.5nM O=C(NC1=CCC=C([C@H]2CCOC2)C1)C3=NC=CN=C3 1mM O=[N+]([O-])C1=CC=C(C2=NNC(SCC#CC)=N2)C=CIC 1mM