Please help answer these questions I need a better understanding of these concepts. Please show all work. Thank you!

1. Use the following condensed structure to draw both a Lewis structure and skeletal structure: CH3CH2C(CH3)2NHCOOCCCH2CHO 2. Determine how each of the structures below is related to the following structure: same molecule, constitutional isomer, or neither. 3. For each of the following determine the number of carbons, hydrogens, heteroatoms, and lone pairs of electrons. C's: HA's: C's: HA's: C's: HA's: H's: Lone Pairs: H's: Lone Pairs: H's: Lone Pairs: 4. Draw two resonance structures for the structure provided. Show curvy arrows to show how you determined the structures. Note: The lone pair(s) suggested by the formal charge are not shown. Place any lone pairs in the original and subsequent structures. - Rank the structures above in terms of: major contributor, minor contributor, and very minor contributor. Explain your reasoning