Question: please help with each question 1. What structure has a parent name heptane? (A) CH3(CH2)2CH(CH3)CH2C(CH3)3 (B) (CH3)3C(CH2)3CH(CH3)CH2CH3 (C) CH3(CH2)2C(CH3)2CH=CHCH2CH3 (D) (CH3)2CHCH(CH3)CH(CH3)2 2. Which compound(s) would
please help with each question
1. What structure has a parent name heptane? (A) CH3(CH2)2CH(CH3)CH2C(CH3)3 (B) (CH3)3C(CH2)3CH(CH3)CH2CH3 (C) CH3(CH2)2C(CH3)2CH=CHCH2CH3 (D) (CH3)2CHCH(CH3)CH(CH3)2 2. Which compound(s) would be expected to be polar (have a dipole moment >0D )? (A) I only (B) IV only (C) II and IV (D) I and III 3. What orbitals overlap to form the indicated CC bond? (A) sp3sp2 (B) sp2sp2 (C) sp2sp (D) spsp3
Step by Step Solution
There are 3 Steps involved in it
1 Expert Approved Answer
Step: 1 Unlock
Question Has Been Solved by an Expert!
Get step-by-step solutions from verified subject matter experts
Step: 2 Unlock
Step: 3 Unlock
