he pH scale was designed to make it convenient to express hydrogen ion concentrations that are small in aqueous solutions. The definiton of is in terms of base 10 logarithms. pH=log[H+] where [H] is the hydrogen ion concentration. a. If the hydrogen ion concentration in a solution is 5.89104mol/L, the pH is b. If the pH of a solution is 3.481, the hydrogen ion concentration is mol/2. The equilibrium constant, K0, for the following reaction is 9.52102 at 350K : CH4(g)+CCl4(g)I2CH2Cl2(g) Calculate the equilibrium concentrations of reactants and product when 0.255 moles of CH4 and 0.255 moles of CCl4 are introduced into a 1.00L vensel at 350K. [CH4]=[CCl4]=[CH2Cl2]=MMM