Question: Hi, I don't know why C has more expected entropy decrease than D. for D l, CO2 is solid while in C, H2O is liquid.

Hi, I don't know why C has more expected entropy decrease than D.
for D l, CO2 is solid while in C, H2O is liquid. So I though the answer would be C.
thank you
9. The reaction with the greatest expected entropy decrease is (A) CH4(g)+2O2(g)CO2(g)+2H2O(g) (B) CH4(l)+2O2(g)CO2(g)+2H2O(g) (C) CH4(g)+2O2(g)CO2(g)+2H2O(l) (D) CH4(g)+2O2(g)CO2(s)+2H2O(g)
Step by Step Solution
There are 3 Steps involved in it
Get step-by-step solutions from verified subject matter experts
