Question: just answer question b Write the mathematical expression for the reaction quotient, Qc, for each of the following reactions: (a) CH4(g)+2O2(g)CO2(g)+2H2O(l) (b) CuSO45H2O(s)CuSO4(s)+5H2O(g)
Write the mathematical expression for the reaction quotient, Qc, for each of the following reactions: (a) CH4(g)+2O2(g)CO2(g)+2H2O(l) (b) CuSO45H2O(s)CuSO4(s)+5H2O(g)
Step by Step Solution
There are 3 Steps involved in it
Get step-by-step solutions from verified subject matter experts
