need help with these questions im really stuck

1. (4 pts/each) Balance each of the following reaction equations and indicate the type of reaction. a) LisPOu (aq) + Pb(NOz) ( aq )LiNO3(aq)+Pby(PO))2(s) b) H2(a)+Cu(NOs)(aq)HNO2(aq)+Cu(s) c) CH4(i)+O2(e)CO+(B)+H2O(O) 4) KCiO3(s)xCi(s)+O2(s) IV. Given the following reaction equation CH4(e)=O3(d)CO2(g)+H3O(OP 1) (2 pts) Balunce this reaction equation. 2) (4 pts) Calalate the number of moles of C2H2 needed to eompletely react with 12 moles of O2 ? 3) (6 pts) What mass of O, is required to react to produce 20.0g of 4;0