Question: please help me how to solve step by step question 3 and 4 2. Which statement concerning the following reaction is correct? 2NO2(g)+114kJ2NO(g)+O2(g) A. The
2. Which statement concerning the following reaction is correct? 2NO2(g)+114kJ2NO(g)+O2(g) A. The reaction is exothermic B. The reactants enthalpy is higher than the products C. The sign of H for the reaction is negative D. The surrounding the absorbing heat energy E. The enthalpy of the products exceeds that of the reactants 3. Which of the following equations represents a reaction with an enthalpy change equal to the heat of formation of liquid ethanol, C2H5OH ? A. 2C(s)+3H2(g)+1/2O2(g)C2H5OH (I) B. C2H5OH(I)2C(s)+3H2(g)+1/2O2(g) C. 2C(s)+6H(g)+O(g)C2H5OH (I) D. C2H5OH(l)2C(s)+6H(g)+O(g) E. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) 4. Use the standard reaction enthalpies given below to determine the reaction enthalpy for the following reaction: 2C(s)+2H2O(g)CH4(g)+CO2(g) Given reaction enthalpies: C(s)+H2O(g)CO(g)+H2(g)CO(g)+H2O(g)CO2(g)+H2(g)CO(g)+3H2(g)CH4(g)+H2O(g)Hnnn=+131.3kJHnnn=41.2kJHmn=206.1kJ
Step by Step Solution
There are 3 Steps involved in it
Get step-by-step solutions from verified subject matter experts
