please help!! Please answer all if possible! :)

Which of the following must increase in order for a process to be spontaneous? entropy of the surroundings entropy of the system entropy of the universe 1 point Consider the image below, is it possible for heat to flow from Y to X ? IX>IY Yes, thermodynamics indicates energy will disperse, so heat cannot flow from cold to hot. No, thermodynamics indicates energy will disperse, so heat cannot flow from cold to hot. No, thermodynamics indicates energy will concentrate, so heat cannot flow from cold to hot. Yes, thermodynamics indicates energy will concentrate, so heat cannot flow from cold to hot. 1 point Which compound would you expect to have the largest molar entropy? CH4(g)CH4(l)C6H14(l)C6H14(g)