1. For each problem below, circle the best answer. In each case, there is only one correct answer A. Which alkene would be most reactive in a Diels-Alder reaction with 1,3butadiene. B. Which compound below would have a peak at the highest chemical shift in its C. Which carbanion would be most stable? D. Which compound below would not absorb UV light above 200nm ? E. Energy is when bonds are formed and is when bonds are broken; therefore, bond dissociation energies are always a. released / consumed / endothermic b. consumed / released / exothermic c. consumed / released / endothermic d. consumed/released/isothermic e. released/consumed/ exothermic F. Consider the bond dissociation energies listed below in kcal/mol. CH3Br=70CH3CH2Br=68(CH3)2CHBr=68(CH3)3CBr=65 These data show that the CBr bond is weakest when bromine is bound to a a. methyl carbon b. quaternary carbon c. primary carbon d. 30 carbon e. 2 carbon G. Which of the following represents the energy levels of the molecular orbitals of cyclopentadienyl anion