please help me understand these questions step by step

Solutions and Stoichiometry Calculations 4. What is the molarity of the solution prepared by dissolving 2.06g of BaCrO42H2O in 500.0 mL of solution? 5. If 50.50mL of 0.750MZnSO4 is diluted to 2.00L solution, what is the concentration of the diluted solution? 6. Consider the following unbalanced reaction: B2H6(e)+O2()H3B3O(())+H2Om If 10.1g of B2H6 gas is reacted with 39.6g of O2 gas, find the following: a. Balance the equation. b. Determine the limiting reactant. c. Calculate the mass of the H2B2O6 solid produced. d. If the reaction produced 28.6g of H3B3O6 solid, calculate the % yield of the reaction